cyclohexane-1,4-dicarboxylic acid,hexane-1,6-diol,terephthalic acid structure
|
Common Name | cyclohexane-1,4-dicarboxylic acid,hexane-1,6-diol,terephthalic acid | ||
|---|---|---|---|---|
| CAS Number | 133066-42-9 | Molecular Weight | 456.48300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H32O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | cyclohexane-1,4-dicarboxylic acid,hexane-1,6-diol,terephthalic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H32O10 |
|---|---|
| Molecular Weight | 456.48300 |
| Exact Mass | 456.20000 |
| PSA | 189.66000 |
| LogP | 2.57640 |
| InChIKey | XVWGZOFNGCVZCR-UHFFFAOYSA-N |
| SMILES | O=C(O)C1CCC(C(=O)O)CC1.O=C(O)c1ccc(C(=O)O)cc1.OCCCCCCO |
| 1,4-Benzenedicarboxylic acid,polymer with 1,4-cyclohexanedicarboxylic acid and 1,6-hexanediol |