[2-(4,6-Dimethyl-pyridin-2-yl)-ethyl]-carbamic acid tert-butyl ester
Modify Date: 2025-08-26 22:12:04
![[2-(4,6-Dimethyl-pyridin-2-yl)-ethyl]-carbamic acid tert-butyl ester Structure](https://www.chemsrc.com/extcaspic/285/1330751-99-9.png)
[2-(4,6-Dimethyl-pyridin-2-yl)-ethyl]-carbamic acid tert-butyl ester structure
|
Common Name | [2-(4,6-Dimethyl-pyridin-2-yl)-ethyl]-carbamic acid tert-butyl ester | ||
|---|---|---|---|---|
| CAS Number | 1330751-99-9 | Molecular Weight | 250.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H22N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [2-(4,6-Dimethyl-pyridin-2-yl)-ethyl]-carbamic acid tert-butyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H22N2O2 |
|---|---|
| Molecular Weight | 250.34 |
| InChIKey | REFYDYRSLSWAFR-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)nc(CCNC(=O)OC(C)(C)C)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of [2-(4,6-Dimethyl-pyridin-2-yl)-ethyl]-carbamic acid tert-butyl ester? |
| A: SMILES notation of [2-(4,6-Dimethyl-pyridin-2-yl)-ethyl]-carbamic acid tert-butyl ester is Cc1cc(C)nc(CCNC(=O)OC(C)(C)C)c1. |
| Q: What is the English name of [2-(4,6-Dimethyl-pyridin-2-yl)-ethyl]-carbamic acid tert-butyl ester? |
| A: The English name of [2-(4,6-Dimethyl-pyridin-2-yl)-ethyl]-carbamic acid tert-butyl ester is [2-(4,6-Dimethyl-pyridin-2-yl)-ethyl]-carbamic acid tert-butyl ester. |
| Q: What is the molecular weight of [2-(4,6-Dimethyl-pyridin-2-yl)-ethyl]-carbamic acid tert-butyl ester? |
| A: Molecular weight of [2-(4,6-Dimethyl-pyridin-2-yl)-ethyl]-carbamic acid tert-butyl ester is 250.34. |
| Q: What is the InChIKey of [2-(4,6-Dimethyl-pyridin-2-yl)-ethyl]-carbamic acid tert-butyl ester? |
| A: InChIKey of [2-(4,6-Dimethyl-pyridin-2-yl)-ethyl]-carbamic acid tert-butyl ester is REFYDYRSLSWAFR-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1330751-99-9? |
| A: Chinese name of 1330751-99-9 is 1330751-99-9. |
| Q: What is the CAS number of [2-(4,6-Dimethyl-pyridin-2-yl)-ethyl]-carbamic acid tert-butyl ester? |
| A: CAS number of [2-(4,6-Dimethyl-pyridin-2-yl)-ethyl]-carbamic acid tert-butyl ester is 1330751-99-9. |
| Q: What is the molecular formula of [2-(4,6-Dimethyl-pyridin-2-yl)-ethyl]-carbamic acid tert-butyl ester? |
| A: Molecular formula of [2-(4,6-Dimethyl-pyridin-2-yl)-ethyl]-carbamic acid tert-butyl ester is C14H22N2O2. |