ethyl (2E)-2-hydroxyimino-3-quinolin-2-yl-propanoate structure
|
Common Name | ethyl (2E)-2-hydroxyimino-3-quinolin-2-yl-propanoate | ||
|---|---|---|---|---|
| CAS Number | 13311-42-7 | Molecular Weight | 258.27300 | |
| Density | 1.226g/cm3 | Boiling Point | 437.146ºC at 760 mmHg | |
| Molecular Formula | C14H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.178ºC | |
| Name | ethyl 2-hydroxyimino-3-quinolin-2-ylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.226g/cm3 |
|---|---|
| Boiling Point | 437.146ºC at 760 mmHg |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.27300 |
| Flash Point | 218.178ºC |
| Exact Mass | 258.10000 |
| PSA | 71.78000 |
| LogP | 2.17060 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | CTVQLBFIRMEBNQ-DTQAZKPQSA-N |
| SMILES | CCOC(=O)C(Cc1ccc2ccccc2n1)=NO |
| HS Code | 2933499090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-hydroxyimino-3-quinolin-2-yl-propionic acid ethyl ester |