2,4-dimethyl-9H-pyrido[2,3-b]indole structure
|
Common Name | 2,4-dimethyl-9H-pyrido[2,3-b]indole | ||
|---|---|---|---|---|
| CAS Number | 13315-71-4 | Molecular Weight | 196.24800 | |
| Density | 1.213g/cm3 | Boiling Point | 384.9ºC at 760 mmHg | |
| Molecular Formula | C13H12N2 | Melting Point | 218-219ºC | |
| MSDS | N/A | Flash Point | 171.8ºC | |
| Name | 2,4-dimethyl-9H-pyrido[2,3-b]indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.213g/cm3 |
|---|---|
| Boiling Point | 384.9ºC at 760 mmHg |
| Melting Point | 218-219ºC |
| Molecular Formula | C13H12N2 |
| Molecular Weight | 196.24800 |
| Flash Point | 171.8ºC |
| Exact Mass | 196.10000 |
| PSA | 28.68000 |
| LogP | 3.33290 |
| Vapour Pressure | 8.79E-06mmHg at 25°C |
| Index of Refraction | 1.723 |
| InChIKey | BZDDKRSSKMTRDZ-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c2c(n1)[nH]c1ccccc12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,4-DIAMINO-1,3-DINITROBENZENE |
| TOS-BB-0955 |
| 9H-2,4-dimethylpyrido[2,3-b]indole |