Anthranilyl-HIV Protease Substrate trifluoroacetate salt structure
|
Common Name | Anthranilyl-HIV Protease Substrate trifluoroacetate salt | ||
|---|---|---|---|---|
| CAS Number | 133233-38-2 | Molecular Weight | 940.057 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C43H65N13O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Anthranilyl-HIV Protease Substrate trifluoroacetate saltAbz-Thr-Ile-Nle-p-nitro-Phe-Gln-Arg-NH2 is a fluorogenic substrate, that can be used for the fluorescence screening assay[1]. |
| Name | N-(2-Aminobenzoyl)-L-threonyl-L-isoleucyl-L-norleucyl-4-nitro-L-phenylalanyl-L-glutaminyl-L-argininamide |
|---|---|
| Synonym | More Synonyms |
| Description | Abz-Thr-Ile-Nle-p-nitro-Phe-Gln-Arg-NH2 is a fluorogenic substrate, that can be used for the fluorescence screening assay[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C43H65N13O11 |
| Molecular Weight | 940.057 |
| Exact Mass | 939.492676 |
| LogP | 1.08 |
| Index of Refraction | 1.646 |
| InChIKey | QIBOWTWGRFTPPW-RSLNUCABSA-N |
| SMILES | CCCCC(NC(=O)C(NC(=O)C(NC(=O)c1ccccc1N)C(C)O)C(C)CC)C(=O)NC(Cc1ccc([N+](=O)[O-])cc1)C(=O)NC(CCC(N)=O)C(=O)NC(CCCN=C(N)N)C(N)=O |
| N-(2-Aminobenzoyl)-L-threonyl-L-isoleucyl-L-norleucyl-4-nitro-L-phenylalanyl-L-glutaminyl-L-argininamide |
| L-Argininamide, N-(2-aminobenzoyl)-L-threonyl-L-isoleucyl-L-norleucyl-4-nitro-L-phenylalanyl-L-glutaminyl- |