4,6-Diamino-1,3-benzenedicarboxylic acid
Modify Date: 2025-09-25 19:01:20
4,6-Diamino-1,3-benzenedicarboxylic acid structure
|
Common Name | 4,6-Diamino-1,3-benzenedicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 13324-94-2 | Molecular Weight | 196.16000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,6-diaminobenzene-1,3-dicarboxylic acid |
|---|
| Molecular Formula | C8H8N2O4 |
|---|---|
| Molecular Weight | 196.16000 |
| Exact Mass | 196.04800 |
| PSA | 126.64000 |
| LogP | 1.40980 |
| InChIKey | ILPDVOFDSNNCNY-UHFFFAOYSA-N |
| SMILES | Nc1cc(N)c(C(=O)O)cc1C(=O)O |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |