Methyl 2'-(bromomethyl)-4-biphenylcarboxylate structure
|
Common Name | Methyl 2'-(bromomethyl)-4-biphenylcarboxylate | ||
|---|---|---|---|---|
| CAS Number | 133240-26-3 | Molecular Weight | 305.167 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 414.0±38.0 °C at 760 mmHg | |
| Molecular Formula | C15H13BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.2±26.8 °C | |
| Name | methyl 2-[4-(bromomethyl)phenyl]benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 414.0±38.0 °C at 760 mmHg |
| Molecular Formula | C15H13BrO2 |
| Molecular Weight | 305.167 |
| Flash Point | 204.2±26.8 °C |
| Exact Mass | 304.009888 |
| PSA | 26.30000 |
| LogP | 4.54 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | KAOWWFUGRAZJFT-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(-c2ccccc2CBr)cc1 |
|
~77%
Methyl 2'-(brom... CAS#:133240-26-3 |
| Literature: Merck and Co., Inc. Patent: US5102880 A1, 1992 ; US 5102880 A |
|
~92%
Methyl 2'-(brom... CAS#:133240-26-3 |
| Literature: Dodo, Kosuke; Aoyama, Atsushi; Noguchi-Yachide, Tomomi; Makishima, Makoto; Miyachi, Hiroyuki; Hashimoto, Yuichi Bioorganic and Medicinal Chemistry, 2008 , vol. 16, # 8 p. 4272 - 4285 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Methyl 2'-(bromomethyl)biphenyl-4-carboxylate |
| Methyl 4'-bromomethyl-2-biphenylcarboxylate |
| Methyl 2'-(bromomethyl)-4-biphenylcarboxylate |
| [1,1'-Biphenyl]-4-carboxylic acid, 2'-(bromomethyl)-, methyl ester |
| 2'-bromomethylbiphenyl-4-carboxylic acid methyl ester |
| MFCD06200816 |