(S)-4-Hydroxy-4-methyl-1,12-dihydro-14H-pyrano[3',4':6,7]indolizino[1,2-b]quinoline-3,14(4H)-dione structure
|
Common Name | (S)-4-Hydroxy-4-methyl-1,12-dihydro-14H-pyrano[3',4':6,7]indolizino[1,2-b]quinoline-3,14(4H)-dione | ||
|---|---|---|---|---|
| CAS Number | 1332610-75-9 | Molecular Weight | 334.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (S)-4-Hydroxy-4-methyl-1,12-dihydro-14H-pyrano[3',4':6,7]indolizino[1,2-b]quinoline-3,14(4H)-dione |
|---|
| Molecular Formula | C19H14N2O4 |
|---|---|
| Molecular Weight | 334.3 |
| InChIKey | GDFIIQKVPKMNFS-IBGZPJMESA-N |
| SMILES | CC1(O)C(=O)OCc2c1cc1n(c2=O)Cc2cc3ccccc3nc2-1 |
|
Name: Cytotoxicity against human renal SN12C cancer cell lines.
Source: ChEMBL
Target: SN12C
External Id: CHEMBL882846
|
|
Name: Inhibitory activity against DNA topoisomerase I; greater activity than the parent com...
Source: ChEMBL
Target: DNA topoisomerase 1
External Id: CHEMBL660712
|
|
Name: Cytotoxicity against human CNSSF-539 cancer cell lines.
Source: ChEMBL
Target: SF-539
External Id: CHEMBL654324
|
|
Name: Mean graph midpoint for growth inhibition of all human cancer cell lines.
Source: ChEMBL
Target: Panel (Carcinoma cell lines)
External Id: CHEMBL694388
|
|
Name: Cytotoxicity against human prostate DU-145 cancer cell lines.
Source: ChEMBL
Target: DU-145
External Id: CHEMBL668030
|
|
Name: Cytotoxicity against human melanoma UACC-62 cancer cell lines.
Source: ChEMBL
Target: UACC-62
External Id: CHEMBL815365
|
|
Name: Cytotoxicity against human ovarian OVCAR-3 cancer cell lines.
Source: ChEMBL
Target: OVCAR-3
External Id: CHEMBL747105
|
|
Name: Cytotoxicity against human breast MIDA-MB-435 cancer cell lines.
Source: ChEMBL
Target: MDA-MB-435
External Id: CHEMBL710001
|
|
Name: Cytotoxicity was determined in human lung HOP-62 cancer cell lines
Source: ChEMBL
Target: HOP-62
External Id: CHEMBL687252
|
|
Name: Cytotoxicity against human colon HCT116 cancer cell lines.
Source: ChEMBL
Target: HCT-116
External Id: CHEMBL883166
|