4-Amino-3-bromo-2,5,7-trimethylquinoline
Modify Date: 2026-08-16 17:55:03
4-Amino-3-bromo-2,5,7-trimethylquinoline structure
|
Common Name | 4-Amino-3-bromo-2,5,7-trimethylquinoline | ||
|---|---|---|---|---|
| CAS Number | 1333252-47-3 | Molecular Weight | 265.15 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13BrN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Amino-3-bromo-2,5,7-trimethylquinoline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H13BrN2 |
|---|---|
| Molecular Weight | 265.15 |
| InChIKey | QKSKKFITBCQQRO-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c2c(N)c(Br)c(C)nc2c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4-Amino-3-bromo-2,5,7-trimethylquinoline? |
| A: The English name of 4-Amino-3-bromo-2,5,7-trimethylquinoline is 4-Amino-3-bromo-2,5,7-trimethylquinoline. |
| Q: What is the InChIKey of 4-Amino-3-bromo-2,5,7-trimethylquinoline? |
| A: InChIKey of 4-Amino-3-bromo-2,5,7-trimethylquinoline is QKSKKFITBCQQRO-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4-Amino-3-bromo-2,5,7-trimethylquinoline? |
| A: Molecular weight of 4-Amino-3-bromo-2,5,7-trimethylquinoline is 265.15. |
| Q: What is the molecular formula of 4-Amino-3-bromo-2,5,7-trimethylquinoline? |
| A: Molecular formula of 4-Amino-3-bromo-2,5,7-trimethylquinoline is C12H13BrN2. |
| Q: What is the SMILES notation of 4-Amino-3-bromo-2,5,7-trimethylquinoline? |
| A: SMILES notation of 4-Amino-3-bromo-2,5,7-trimethylquinoline is Cc1cc(C)c2c(N)c(Br)c(C)nc2c1. |
| Q: What is the CAS number of 4-Amino-3-bromo-2,5,7-trimethylquinoline? |
| A: CAS number of 4-Amino-3-bromo-2,5,7-trimethylquinoline is 1333252-47-3. |
| Q: What is the Chinese name of 1333252-47-3? |
| A: Chinese name of 1333252-47-3 is 1333252-47-3. |