3,5,8-Trichloro-2-methyl-4-(piperazin-1-yl)quinoline hydrochloride structure
|
Common Name | 3,5,8-Trichloro-2-methyl-4-(piperazin-1-yl)quinoline hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1333253-22-7 | Molecular Weight | 367.1 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15Cl4N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,5,8-Trichloro-2-methyl-4-(piperazin-1-yl)quinoline hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H15Cl4N3 |
|---|---|
| Molecular Weight | 367.1 |
| InChIKey | FFJMOOSIVWKTNY-UHFFFAOYSA-N |
| SMILES | Cc1nc2c(Cl)ccc(Cl)c2c(N2CCNCC2)c1Cl.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3,5,8-Trichloro-2-methyl-4-(piperazin-1-yl)quinoline hydrochloride? |
| A: Molecular formula of 3,5,8-Trichloro-2-methyl-4-(piperazin-1-yl)quinoline hydrochloride is C14H15Cl4N3. |
| Q: What is the molecular weight of 3,5,8-Trichloro-2-methyl-4-(piperazin-1-yl)quinoline hydrochloride? |
| A: Molecular weight of 3,5,8-Trichloro-2-methyl-4-(piperazin-1-yl)quinoline hydrochloride is 367.1. |
| Q: What is the SMILES notation of 3,5,8-Trichloro-2-methyl-4-(piperazin-1-yl)quinoline hydrochloride? |
| A: SMILES notation of 3,5,8-Trichloro-2-methyl-4-(piperazin-1-yl)quinoline hydrochloride is Cc1nc2c(Cl)ccc(Cl)c2c(N2CCNCC2)c1Cl.Cl. |
| Q: What is the CAS number of 3,5,8-Trichloro-2-methyl-4-(piperazin-1-yl)quinoline hydrochloride? |
| A: CAS number of 3,5,8-Trichloro-2-methyl-4-(piperazin-1-yl)quinoline hydrochloride is 1333253-22-7. |
| Q: What is the English name of 3,5,8-Trichloro-2-methyl-4-(piperazin-1-yl)quinoline hydrochloride? |
| A: The English name of 3,5,8-Trichloro-2-methyl-4-(piperazin-1-yl)quinoline hydrochloride is 3,5,8-Trichloro-2-methyl-4-(piperazin-1-yl)quinoline hydrochloride. |
| Q: What is the InChIKey of 3,5,8-Trichloro-2-methyl-4-(piperazin-1-yl)quinoline hydrochloride? |
| A: InChIKey of 3,5,8-Trichloro-2-methyl-4-(piperazin-1-yl)quinoline hydrochloride is FFJMOOSIVWKTNY-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1333253-22-7? |
| A: Chinese name of 1333253-22-7 is 1333253-22-7. |