2,5,7-Trimethylquinoline-3-carbohydrazide
Modify Date: 2025-09-10 02:43:10
2,5,7-Trimethylquinoline-3-carbohydrazide structure
|
Common Name | 2,5,7-Trimethylquinoline-3-carbohydrazide | ||
|---|---|---|---|---|
| CAS Number | 1333253-80-7 | Molecular Weight | 229.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,5,7-Trimethylquinoline-3-carbohydrazide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H15N3O |
|---|---|
| Molecular Weight | 229.28 |
| InChIKey | GQGLYEDXDNEKHE-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c2cc(C(=O)NN)c(C)nc2c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2,5,7-Trimethylquinoline-3-carbohydrazide? |
| A: Molecular weight of 2,5,7-Trimethylquinoline-3-carbohydrazide is 229.28. |
| Q: What is the CAS number of 2,5,7-Trimethylquinoline-3-carbohydrazide? |
| A: CAS number of 2,5,7-Trimethylquinoline-3-carbohydrazide is 1333253-80-7. |
| Q: What is the InChIKey of 2,5,7-Trimethylquinoline-3-carbohydrazide? |
| A: InChIKey of 2,5,7-Trimethylquinoline-3-carbohydrazide is GQGLYEDXDNEKHE-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1333253-80-7? |
| A: Chinese name of 1333253-80-7 is 1333253-80-7. |
| Q: What is the SMILES notation of 2,5,7-Trimethylquinoline-3-carbohydrazide? |
| A: SMILES notation of 2,5,7-Trimethylquinoline-3-carbohydrazide is Cc1cc(C)c2cc(C(=O)NN)c(C)nc2c1. |
| Q: What is the molecular formula of 2,5,7-Trimethylquinoline-3-carbohydrazide? |
| A: Molecular formula of 2,5,7-Trimethylquinoline-3-carbohydrazide is C13H15N3O. |
| Q: What is the English name of 2,5,7-Trimethylquinoline-3-carbohydrazide? |
| A: The English name of 2,5,7-Trimethylquinoline-3-carbohydrazide is 2,5,7-Trimethylquinoline-3-carbohydrazide. |