3-Chloro-2-methyl-4-(piperazin-1-yl)-6-(trifluoromethyl)quinoline hydrochloride structure
|
Common Name | 3-Chloro-2-methyl-4-(piperazin-1-yl)-6-(trifluoromethyl)quinoline hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1333253-82-9 | Molecular Weight | 366.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16Cl2F3N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Chloro-2-methyl-4-(piperazin-1-yl)-6-(trifluoromethyl)quinoline hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H16Cl2F3N3 |
|---|---|
| Molecular Weight | 366.2 |
| InChIKey | JHCPOUUZHIZMSA-UHFFFAOYSA-N |
| SMILES | Cc1nc2ccc(C(F)(F)F)cc2c(N2CCNCC2)c1Cl.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 3-Chloro-2-methyl-4-(piperazin-1-yl)-6-(trifluoromethyl)quinoline hydrochloride? |
| A: SMILES notation of 3-Chloro-2-methyl-4-(piperazin-1-yl)-6-(trifluoromethyl)quinoline hydrochloride is Cc1nc2ccc(C(F)(F)F)cc2c(N2CCNCC2)c1Cl.Cl. |
| Q: What is the InChIKey of 3-Chloro-2-methyl-4-(piperazin-1-yl)-6-(trifluoromethyl)quinoline hydrochloride? |
| A: InChIKey of 3-Chloro-2-methyl-4-(piperazin-1-yl)-6-(trifluoromethyl)quinoline hydrochloride is JHCPOUUZHIZMSA-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1333253-82-9? |
| A: Chinese name of 1333253-82-9 is 1333253-82-9. |
| Q: What is the CAS number of 3-Chloro-2-methyl-4-(piperazin-1-yl)-6-(trifluoromethyl)quinoline hydrochloride? |
| A: CAS number of 3-Chloro-2-methyl-4-(piperazin-1-yl)-6-(trifluoromethyl)quinoline hydrochloride is 1333253-82-9. |
| Q: What is the molecular formula of 3-Chloro-2-methyl-4-(piperazin-1-yl)-6-(trifluoromethyl)quinoline hydrochloride? |
| A: Molecular formula of 3-Chloro-2-methyl-4-(piperazin-1-yl)-6-(trifluoromethyl)quinoline hydrochloride is C15H16Cl2F3N3. |
| Q: What is the molecular weight of 3-Chloro-2-methyl-4-(piperazin-1-yl)-6-(trifluoromethyl)quinoline hydrochloride? |
| A: Molecular weight of 3-Chloro-2-methyl-4-(piperazin-1-yl)-6-(trifluoromethyl)quinoline hydrochloride is 366.2. |
| Q: What is the English name of 3-Chloro-2-methyl-4-(piperazin-1-yl)-6-(trifluoromethyl)quinoline hydrochloride? |
| A: The English name of 3-Chloro-2-methyl-4-(piperazin-1-yl)-6-(trifluoromethyl)quinoline hydrochloride is 3-Chloro-2-methyl-4-(piperazin-1-yl)-6-(trifluoromethyl)quinoline hydrochloride. |