2-Methyl-3,4,8-tribromoquinoline
Modify Date: 2025-09-09 13:53:12
2-Methyl-3,4,8-tribromoquinoline structure
|
Common Name | 2-Methyl-3,4,8-tribromoquinoline | ||
|---|---|---|---|---|
| CAS Number | 1333255-43-8 | Molecular Weight | 379.87 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H6Br3N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Methyl-3,4,8-tribromoquinoline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H6Br3N |
|---|---|
| Molecular Weight | 379.87 |
| InChIKey | POBDPLCVOFQGJO-UHFFFAOYSA-N |
| SMILES | Cc1nc2c(Br)cccc2c(Br)c1Br |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-Methyl-3,4,8-tribromoquinoline? |
| A: Molecular formula of 2-Methyl-3,4,8-tribromoquinoline is C10H6Br3N. |
| Q: What is the CAS number of 2-Methyl-3,4,8-tribromoquinoline? |
| A: CAS number of 2-Methyl-3,4,8-tribromoquinoline is 1333255-43-8. |
| Q: What is the SMILES notation of 2-Methyl-3,4,8-tribromoquinoline? |
| A: SMILES notation of 2-Methyl-3,4,8-tribromoquinoline is Cc1nc2c(Br)cccc2c(Br)c1Br. |
| Q: What is the Chinese name of 1333255-43-8? |
| A: Chinese name of 1333255-43-8 is 1333255-43-8. |
| Q: What is the molecular weight of 2-Methyl-3,4,8-tribromoquinoline? |
| A: Molecular weight of 2-Methyl-3,4,8-tribromoquinoline is 379.87. |
| Q: What is the InChIKey of 2-Methyl-3,4,8-tribromoquinoline? |
| A: InChIKey of 2-Methyl-3,4,8-tribromoquinoline is POBDPLCVOFQGJO-UHFFFAOYSA-N. |
| Q: What is the English name of 2-Methyl-3,4,8-tribromoquinoline? |
| A: The English name of 2-Methyl-3,4,8-tribromoquinoline is 2-Methyl-3,4,8-tribromoquinoline. |