4-Amino-3-bromo-5-chloro-2,8-dimethylquinoline
Modify Date: 2025-08-22 12:23:50
4-Amino-3-bromo-5-chloro-2,8-dimethylquinoline structure
|
Common Name | 4-Amino-3-bromo-5-chloro-2,8-dimethylquinoline | ||
|---|---|---|---|---|
| CAS Number | 1333255-97-2 | Molecular Weight | 285.57 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10BrClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Amino-3-bromo-5-chloro-2,8-dimethylquinoline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H10BrClN2 |
|---|---|
| Molecular Weight | 285.57 |
| InChIKey | IOBAESNAWOFATE-UHFFFAOYSA-N |
| SMILES | Cc1nc2c(C)ccc(Cl)c2c(N)c1Br |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4-Amino-3-bromo-5-chloro-2,8-dimethylquinoline? |
| A: InChIKey of 4-Amino-3-bromo-5-chloro-2,8-dimethylquinoline is IOBAESNAWOFATE-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 4-Amino-3-bromo-5-chloro-2,8-dimethylquinoline? |
| A: Molecular formula of 4-Amino-3-bromo-5-chloro-2,8-dimethylquinoline is C11H10BrClN2. |
| Q: What is the molecular weight of 4-Amino-3-bromo-5-chloro-2,8-dimethylquinoline? |
| A: Molecular weight of 4-Amino-3-bromo-5-chloro-2,8-dimethylquinoline is 285.57. |
| Q: What is the SMILES notation of 4-Amino-3-bromo-5-chloro-2,8-dimethylquinoline? |
| A: SMILES notation of 4-Amino-3-bromo-5-chloro-2,8-dimethylquinoline is Cc1nc2c(C)ccc(Cl)c2c(N)c1Br. |
| Q: What is the CAS number of 4-Amino-3-bromo-5-chloro-2,8-dimethylquinoline? |
| A: CAS number of 4-Amino-3-bromo-5-chloro-2,8-dimethylquinoline is 1333255-97-2. |
| Q: What is the Chinese name of 1333255-97-2? |
| A: Chinese name of 1333255-97-2 is 1333255-97-2. |
| Q: What is the English name of 4-Amino-3-bromo-5-chloro-2,8-dimethylquinoline? |
| A: The English name of 4-Amino-3-bromo-5-chloro-2,8-dimethylquinoline is 4-Amino-3-bromo-5-chloro-2,8-dimethylquinoline. |