3,4-Dibromo-2-methyl-8-(trifluoromethoxy)quinoline
Modify Date: 2026-07-01 19:14:47
3,4-Dibromo-2-methyl-8-(trifluoromethoxy)quinoline structure
|
Common Name | 3,4-Dibromo-2-methyl-8-(trifluoromethoxy)quinoline | ||
|---|---|---|---|---|
| CAS Number | 1333257-06-9 | Molecular Weight | 384.97 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H6Br2F3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,4-Dibromo-2-methyl-8-(trifluoromethoxy)quinoline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H6Br2F3NO |
|---|---|
| Molecular Weight | 384.97 |
| InChIKey | WSYOEQVHPOKLAF-UHFFFAOYSA-N |
| SMILES | Cc1nc2c(OC(F)(F)F)cccc2c(Br)c1Br |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3,4-Dibromo-2-methyl-8-(trifluoromethoxy)quinoline? |
| A: Molecular formula of 3,4-Dibromo-2-methyl-8-(trifluoromethoxy)quinoline is C11H6Br2F3NO. |
| Q: What is the Chinese name of 1333257-06-9? |
| A: Chinese name of 1333257-06-9 is 1333257-06-9. |
| Q: What is the English name of 3,4-Dibromo-2-methyl-8-(trifluoromethoxy)quinoline? |
| A: The English name of 3,4-Dibromo-2-methyl-8-(trifluoromethoxy)quinoline is 3,4-Dibromo-2-methyl-8-(trifluoromethoxy)quinoline. |
| Q: What is the molecular weight of 3,4-Dibromo-2-methyl-8-(trifluoromethoxy)quinoline? |
| A: Molecular weight of 3,4-Dibromo-2-methyl-8-(trifluoromethoxy)quinoline is 384.97. |
| Q: What is the CAS number of 3,4-Dibromo-2-methyl-8-(trifluoromethoxy)quinoline? |
| A: CAS number of 3,4-Dibromo-2-methyl-8-(trifluoromethoxy)quinoline is 1333257-06-9. |
| Q: What is the SMILES notation of 3,4-Dibromo-2-methyl-8-(trifluoromethoxy)quinoline? |
| A: SMILES notation of 3,4-Dibromo-2-methyl-8-(trifluoromethoxy)quinoline is Cc1nc2c(OC(F)(F)F)cccc2c(Br)c1Br. |
| Q: What is the InChIKey of 3,4-Dibromo-2-methyl-8-(trifluoromethoxy)quinoline? |
| A: InChIKey of 3,4-Dibromo-2-methyl-8-(trifluoromethoxy)quinoline is WSYOEQVHPOKLAF-UHFFFAOYSA-N. |