4-Amino-3-bromo-5,7-difluoro-2-methylquinoline
Modify Date: 2025-09-09 12:12:50
4-Amino-3-bromo-5,7-difluoro-2-methylquinoline structure
|
Common Name | 4-Amino-3-bromo-5,7-difluoro-2-methylquinoline | ||
|---|---|---|---|---|
| CAS Number | 1333258-40-4 | Molecular Weight | 273.08 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7BrF2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Amino-3-bromo-5,7-difluoro-2-methylquinoline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H7BrF2N2 |
|---|---|
| Molecular Weight | 273.08 |
| InChIKey | RFOWGIGJDRCDQU-UHFFFAOYSA-N |
| SMILES | Cc1nc2cc(F)cc(F)c2c(N)c1Br |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4-Amino-3-bromo-5,7-difluoro-2-methylquinoline? |
| A: Molecular weight of 4-Amino-3-bromo-5,7-difluoro-2-methylquinoline is 273.08. |
| Q: What is the InChIKey of 4-Amino-3-bromo-5,7-difluoro-2-methylquinoline? |
| A: InChIKey of 4-Amino-3-bromo-5,7-difluoro-2-methylquinoline is RFOWGIGJDRCDQU-UHFFFAOYSA-N. |
| Q: What is the CAS number of 4-Amino-3-bromo-5,7-difluoro-2-methylquinoline? |
| A: CAS number of 4-Amino-3-bromo-5,7-difluoro-2-methylquinoline is 1333258-40-4. |
| Q: What is the molecular formula of 4-Amino-3-bromo-5,7-difluoro-2-methylquinoline? |
| A: Molecular formula of 4-Amino-3-bromo-5,7-difluoro-2-methylquinoline is C10H7BrF2N2. |
| Q: What is the Chinese name of 1333258-40-4? |
| A: Chinese name of 1333258-40-4 is 1333258-40-4. |
| Q: What is the SMILES notation of 4-Amino-3-bromo-5,7-difluoro-2-methylquinoline? |
| A: SMILES notation of 4-Amino-3-bromo-5,7-difluoro-2-methylquinoline is Cc1nc2cc(F)cc(F)c2c(N)c1Br. |
| Q: What is the English name of 4-Amino-3-bromo-5,7-difluoro-2-methylquinoline? |
| A: The English name of 4-Amino-3-bromo-5,7-difluoro-2-methylquinoline is 4-Amino-3-bromo-5,7-difluoro-2-methylquinoline. |