Lydicamycin structure
|
Common Name | Lydicamycin | ||
|---|---|---|---|---|
| CAS Number | 133352-27-9 | Molecular Weight | 855.11 | |
| Density | 1.3g/cm3 | Boiling Point | 1030.3ºC at 760mmHg | |
| Molecular Formula | C47H74N4O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 576.9ºC | |
Use of LydicamycinLydicamycin is an antibiotic isolated from the fermentation broth of an actinomycete strain identified as Streptomyces lydicus. Lydicamycin is active against Gram-positive bacteria and a certain yeast, but inactive against Gram-negative bacteria[1]. |
| Name | lydicamycin |
|---|---|
| Synonym | More Synonyms |
| Description | Lydicamycin is an antibiotic isolated from the fermentation broth of an actinomycete strain identified as Streptomyces lydicus. Lydicamycin is active against Gram-positive bacteria and a certain yeast, but inactive against Gram-negative bacteria[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 1030.3ºC at 760mmHg |
| Molecular Formula | C47H74N4O10 |
| Molecular Weight | 855.11 |
| Flash Point | 576.9ºC |
| Exact Mass | 854.54000 |
| PSA | 261.12000 |
| LogP | 4.67470 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.612 |
| InChIKey | HNSRCWWMQWCNGW-UDQMVHKASA-N |
| SMILES | CC(=CCC(O)CC1CCCN1C(=N)N)C(O)CC=CC(O)C(C)C=CC(O)CC=C(C)C(O)C(C)CCC1C(C)=CC2C(O)C(O)CCC2C1(C)C(O)=C1C(=O)CNC1=O |
| Echinatine,N-oxide |
| Indicine N-oxide |
| INDI |
| lycopsamine A N-oxide |