Ethyl 3-hydroxy-1-oxa-8-azaspiro[4.5]decane-8-carboxylate structure
|
Common Name | Ethyl 3-hydroxy-1-oxa-8-azaspiro[4.5]decane-8-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 133382-30-6 | Molecular Weight | 229.27300 | |
| Density | 1.222g/cm3 | Boiling Point | 381.439ºC at 760 mmHg | |
| Molecular Formula | C11H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.488ºC | |
| Name | Ethyl 3-hydroxy-1-oxa-8-azaspiro[4.5]decane-8-carboxylate |
|---|
| Density | 1.222g/cm3 |
|---|---|
| Boiling Point | 381.439ºC at 760 mmHg |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.27300 |
| Flash Point | 184.488ºC |
| Exact Mass | 229.13100 |
| PSA | 59.00000 |
| LogP | 0.69660 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.529 |
| InChIKey | UARTZSLRRHJQMX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1CCC2(CC1)CC(O)CO2 |
|
~%
Ethyl 3-hydroxy... CAS#:133382-30-6 |
| Literature: Fisons Corporation Patent: US5075317 A1, 1991 ; US 5075317 A |
|
~%
Ethyl 3-hydroxy... CAS#:133382-30-6 |
| Literature: Wu; Griffith; Loch III; Kover; Murray; Mullen; Blosser; Machulskis; McCreedy Journal of Medicinal Chemistry, 1995 , vol. 38, # 9 p. 1558 - 1570 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |