Methyl 2-Methoxy-1-Naphthoate structure
|
Common Name | Methyl 2-Methoxy-1-Naphthoate | ||
|---|---|---|---|---|
| CAS Number | 13343-92-5 | Molecular Weight | 216.23300 | |
| Density | 1.166g/cm3 | Boiling Point | 120-121ºC0.05 mm Hg(lit.) | |
| Molecular Formula | C13H12O3 | Melting Point | 50-53ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Name | methyl 2-methoxynaphthalene-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.166g/cm3 |
|---|---|
| Boiling Point | 120-121ºC0.05 mm Hg(lit.) |
| Melting Point | 50-53ºC(lit.) |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.23300 |
| Flash Point | >230 °F |
| Exact Mass | 216.07900 |
| PSA | 35.53000 |
| LogP | 2.63500 |
| Vapour Pressure | 4.69E-05mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | BDXGQHHFVPQVAQ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c(OC)ccc2ccccc12 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2918990090 |
| Precursor 9 | |
|---|---|
| DownStream 5 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
The Reaction of Phenyl 2-Methoxy-1-naphthoate with Grignard Reagents. A New Route to Fluorenones. Fuson RC and Wassmundt FW.
J. Am. Chem. Soc. 78(20) , 5409-5413, (1956)
|
|
|
Transannular methanol adducts of a photo-dimer from methyl 2-Methoxy-1-naphthoate. Teitei T and Wells D.
Aust. J. Chem. 29(3) , 649-654, (1976)
|
| MFCD02683513 |
| 2,1-Methoxy-naphthoe-saeuremethylester |
| Methyl 2-methoxy-1-naphthoate |
| methyl 2-methoxy-5,6,7,8-tetrahydro-1-naphthoate |
| 2-Methoxy-1-methoxycarbonyl-naphthalin |
| 2-Methoxy-[1]naphthoesaeure-methylester |
| methyl ester of 2-methoxy-1-naphthalenecarboxylic acid |
| Methyl 2-methoxynaphthoate |
| 2-methoxy-[1]naphthoic acid methyl ester |