Ethyl 5,7-difluoro-3-iodo-1H-indole-2-carboxylate structure
|
Common Name | Ethyl 5,7-difluoro-3-iodo-1H-indole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1334499-90-9 | Molecular Weight | 351.088 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 401.4±40.0 °C at 760 mmHg | |
| Molecular Formula | C11H8F2INO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.6±27.3 °C | |
| Name | Ethyl 5,7-difluoro-3-iodo-1H-indole-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 401.4±40.0 °C at 760 mmHg |
| Molecular Formula | C11H8F2INO2 |
| Molecular Weight | 351.088 |
| Flash Point | 196.6±27.3 °C |
| Exact Mass | 350.956757 |
| PSA | 42.09000 |
| LogP | 3.87 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.646 |
| InChIKey | MYSHVVLTGACSTO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1[nH]c2c(F)cc(F)cc2c1I |
| Storage condition | 2-8°C |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indole-2-carboxylic acid, 5,7-difluoro-3-iodo-, ethyl ester |
| sc1040 |
| Ethyl 5,7-difluoro-3-iodo-1H-indole-2-carboxylate |
| x9858 |