2-Naphthalenecarboxylic acid, 6-(1,1-dimethylethyl)-1,2,3,4-tetrahydro-4-oxo-, methyl ester
Modify Date: 2025-08-27 13:29:08
2-Naphthalenecarboxylic acid, 6-(1,1-dimethylethyl)-1,2,3,4-tetrahydro-4-oxo-, methyl ester structure
|
Common Name | 2-Naphthalenecarboxylic acid, 6-(1,1-dimethylethyl)-1,2,3,4-tetrahydro-4-oxo-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 1334627-22-3 | Molecular Weight | 260.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Naphthalenecarboxylic acid, 6-(1,1-dimethylethyl)-1,2,3,4-tetrahydro-4-oxo-, methyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H20O3 |
|---|---|
| Molecular Weight | 260.33 |
| InChIKey | UINSMBXXFMVTKI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC(=O)c2cc(C(C)(C)C)ccc2C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-Naphthalenecarboxylic acid, 6-(1,1-dimethylethyl)-1,2,3,4-tetrahydro-4-oxo-, methyl ester? |
| A: SMILES notation of 2-Naphthalenecarboxylic acid, 6-(1,1-dimethylethyl)-1,2,3,4-tetrahydro-4-oxo-, methyl ester is COC(=O)C1CC(=O)c2cc(C(C)(C)C)ccc2C1. |
| Q: What is the molecular formula of 2-Naphthalenecarboxylic acid, 6-(1,1-dimethylethyl)-1,2,3,4-tetrahydro-4-oxo-, methyl ester? |
| A: Molecular formula of 2-Naphthalenecarboxylic acid, 6-(1,1-dimethylethyl)-1,2,3,4-tetrahydro-4-oxo-, methyl ester is C16H20O3. |
| Q: What is the CAS number of 2-Naphthalenecarboxylic acid, 6-(1,1-dimethylethyl)-1,2,3,4-tetrahydro-4-oxo-, methyl ester? |
| A: CAS number of 2-Naphthalenecarboxylic acid, 6-(1,1-dimethylethyl)-1,2,3,4-tetrahydro-4-oxo-, methyl ester is 1334627-22-3. |
| Q: What is the molecular weight of 2-Naphthalenecarboxylic acid, 6-(1,1-dimethylethyl)-1,2,3,4-tetrahydro-4-oxo-, methyl ester? |
| A: Molecular weight of 2-Naphthalenecarboxylic acid, 6-(1,1-dimethylethyl)-1,2,3,4-tetrahydro-4-oxo-, methyl ester is 260.33. |
| Q: What is the English name of 2-Naphthalenecarboxylic acid, 6-(1,1-dimethylethyl)-1,2,3,4-tetrahydro-4-oxo-, methyl ester? |
| A: The English name of 2-Naphthalenecarboxylic acid, 6-(1,1-dimethylethyl)-1,2,3,4-tetrahydro-4-oxo-, methyl ester is 2-Naphthalenecarboxylic acid, 6-(1,1-dimethylethyl)-1,2,3,4-tetrahydro-4-oxo-, methyl ester. |
| Q: What is the InChIKey of 2-Naphthalenecarboxylic acid, 6-(1,1-dimethylethyl)-1,2,3,4-tetrahydro-4-oxo-, methyl ester? |
| A: InChIKey of 2-Naphthalenecarboxylic acid, 6-(1,1-dimethylethyl)-1,2,3,4-tetrahydro-4-oxo-, methyl ester is UINSMBXXFMVTKI-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1334627-22-3? |
| A: Chinese name of 1334627-22-3 is 1334627-22-3. |