ethyl N-[(2,5-difluorophenyl)carbamothioyl]carbamate
Modify Date: 2026-07-29 19:30:48
![ethyl N-[(2,5-difluorophenyl)carbamothioyl]carbamate Structure](https://www.chemsrc.com/extcaspic/271/1334631-34-3.png)
ethyl N-[(2,5-difluorophenyl)carbamothioyl]carbamate structure
|
Common Name | ethyl N-[(2,5-difluorophenyl)carbamothioyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 1334631-34-3 | Molecular Weight | 260.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10F2N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl N-[(2,5-difluorophenyl)carbamothioyl]carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H10F2N2O2S |
|---|---|
| Molecular Weight | 260.26 |
| InChIKey | KZTUYMNGZCZRJG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NC(=S)Nc1cc(F)ccc1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of ethyl N-[(2,5-difluorophenyl)carbamothioyl]carbamate? |
| A: Molecular weight of ethyl N-[(2,5-difluorophenyl)carbamothioyl]carbamate is 260.26. |
| Q: What is the English name of ethyl N-[(2,5-difluorophenyl)carbamothioyl]carbamate? |
| A: The English name of ethyl N-[(2,5-difluorophenyl)carbamothioyl]carbamate is ethyl N-[(2,5-difluorophenyl)carbamothioyl]carbamate. |
| Q: What is the CAS number of ethyl N-[(2,5-difluorophenyl)carbamothioyl]carbamate? |
| A: CAS number of ethyl N-[(2,5-difluorophenyl)carbamothioyl]carbamate is 1334631-34-3. |
| Q: What is the SMILES notation of ethyl N-[(2,5-difluorophenyl)carbamothioyl]carbamate? |
| A: SMILES notation of ethyl N-[(2,5-difluorophenyl)carbamothioyl]carbamate is CCOC(=O)NC(=S)Nc1cc(F)ccc1F. |
| Q: What is the InChIKey of ethyl N-[(2,5-difluorophenyl)carbamothioyl]carbamate? |
| A: InChIKey of ethyl N-[(2,5-difluorophenyl)carbamothioyl]carbamate is KZTUYMNGZCZRJG-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1334631-34-3? |
| A: Chinese name of 1334631-34-3 is 1334631-34-3. |
| Q: What is the molecular formula of ethyl N-[(2,5-difluorophenyl)carbamothioyl]carbamate? |
| A: Molecular formula of ethyl N-[(2,5-difluorophenyl)carbamothioyl]carbamate is C10H10F2N2O2S. |