Methyl 4'-propyl-[1,1'-biphenyl]-4-carboxylate
Modify Date: 2026-07-01 09:56:25
![Methyl 4'-propyl-[1,1'-biphenyl]-4-carboxylate Structure](https://www.chemsrc.com/extcaspic/267/1334647-63-0.png)
Methyl 4'-propyl-[1,1'-biphenyl]-4-carboxylate structure
|
Common Name | Methyl 4'-propyl-[1,1'-biphenyl]-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1334647-63-0 | Molecular Weight | 254.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 4'-propyl-[1,1'-biphenyl]-4-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H18O2 |
|---|---|
| Molecular Weight | 254.32 |
| InChIKey | PQOLVEQOZBXYCI-UHFFFAOYSA-N |
| SMILES | CCCc1ccc(-c2ccc(C(=O)OC)cc2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Methyl 4'-propyl-[1,1'-biphenyl]-4-carboxylate? |
| A: Molecular formula of Methyl 4'-propyl-[1,1'-biphenyl]-4-carboxylate is C17H18O2. |
| Q: What is the SMILES notation of Methyl 4'-propyl-[1,1'-biphenyl]-4-carboxylate? |
| A: SMILES notation of Methyl 4'-propyl-[1,1'-biphenyl]-4-carboxylate is CCCc1ccc(-c2ccc(C(=O)OC)cc2)cc1. |
| Q: What is the InChIKey of Methyl 4'-propyl-[1,1'-biphenyl]-4-carboxylate? |
| A: InChIKey of Methyl 4'-propyl-[1,1'-biphenyl]-4-carboxylate is PQOLVEQOZBXYCI-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Methyl 4'-propyl-[1,1'-biphenyl]-4-carboxylate? |
| A: Molecular weight of Methyl 4'-propyl-[1,1'-biphenyl]-4-carboxylate is 254.32. |
| Q: What is the CAS number of Methyl 4'-propyl-[1,1'-biphenyl]-4-carboxylate? |
| A: CAS number of Methyl 4'-propyl-[1,1'-biphenyl]-4-carboxylate is 1334647-63-0. |
| Q: What is the Chinese name of 1334647-63-0? |
| A: Chinese name of 1334647-63-0 is 1334647-63-0. |
| Q: What is the English name of Methyl 4'-propyl-[1,1'-biphenyl]-4-carboxylate? |
| A: The English name of Methyl 4'-propyl-[1,1'-biphenyl]-4-carboxylate is Methyl 4'-propyl-[1,1'-biphenyl]-4-carboxylate. |