2-(1,2-Oxazol-5-YL)benzene-1-sulfonyl fluoride
Modify Date: 2026-07-15 20:07:25
2-(1,2-Oxazol-5-YL)benzene-1-sulfonyl fluoride structure
|
Common Name | 2-(1,2-Oxazol-5-YL)benzene-1-sulfonyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 1334653-40-5 | Molecular Weight | 227.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H6FNO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(1,2-Oxazol-5-YL)benzene-1-sulfonyl fluoride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H6FNO3S |
|---|---|
| Molecular Weight | 227.21 |
| InChIKey | FQBNBOIXLWNLHP-UHFFFAOYSA-N |
| SMILES | O=S(=O)(F)c1ccccc1-c1ccno1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-(1,2-Oxazol-5-YL)benzene-1-sulfonyl fluoride? |
| A: CAS number of 2-(1,2-Oxazol-5-YL)benzene-1-sulfonyl fluoride is 1334653-40-5. |
| Q: What is the molecular weight of 2-(1,2-Oxazol-5-YL)benzene-1-sulfonyl fluoride? |
| A: Molecular weight of 2-(1,2-Oxazol-5-YL)benzene-1-sulfonyl fluoride is 227.21. |
| Q: What is the molecular formula of 2-(1,2-Oxazol-5-YL)benzene-1-sulfonyl fluoride? |
| A: Molecular formula of 2-(1,2-Oxazol-5-YL)benzene-1-sulfonyl fluoride is C9H6FNO3S. |
| Q: What is the Chinese name of 1334653-40-5? |
| A: Chinese name of 1334653-40-5 is 1334653-40-5. |
| Q: What is the English name of 2-(1,2-Oxazol-5-YL)benzene-1-sulfonyl fluoride? |
| A: The English name of 2-(1,2-Oxazol-5-YL)benzene-1-sulfonyl fluoride is 2-(1,2-Oxazol-5-YL)benzene-1-sulfonyl fluoride. |
| Q: What is the InChIKey of 2-(1,2-Oxazol-5-YL)benzene-1-sulfonyl fluoride? |
| A: InChIKey of 2-(1,2-Oxazol-5-YL)benzene-1-sulfonyl fluoride is FQBNBOIXLWNLHP-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-(1,2-Oxazol-5-YL)benzene-1-sulfonyl fluoride? |
| A: SMILES notation of 2-(1,2-Oxazol-5-YL)benzene-1-sulfonyl fluoride is O=S(=O)(F)c1ccccc1-c1ccno1. |