α-[3-(Dimethylamino)propyl]-α-isopropyl-1-naphthaleneacetic acid propyl ester structure
|
Common Name | α-[3-(Dimethylamino)propyl]-α-isopropyl-1-naphthaleneacetic acid propyl ester | ||
|---|---|---|---|---|
| CAS Number | 13349-33-2 | Molecular Weight | 355.51400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H33NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | propyl 5-(dimethylamino)-2-naphthalen-1-yl-2-propan-2-ylpentanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H33NO2 |
|---|---|
| Molecular Weight | 355.51400 |
| Exact Mass | 355.25100 |
| PSA | 29.54000 |
| LogP | 5.02860 |
| Vapour Pressure | 7.93E-09mmHg at 25°C |
| InChIKey | OEKSQKIRLROKDH-UHFFFAOYSA-N |
| SMILES | CCCOC(=O)C(CCCN(C)C)(c1cccc2ccccc12)C(C)C |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| propyl 5-(dimethylamino)-2-(naphthalen-1-yl)-2-(propan-2-yl)pentanoate |