1,3,5-trinitro-2-[2-[4-[2-(2,4,6-trinitrophenyl)ethenyl]phenyl]ethenyl]benzene structure
|
Common Name | 1,3,5-trinitro-2-[2-[4-[2-(2,4,6-trinitrophenyl)ethenyl]phenyl]ethenyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 133502-79-1 | Molecular Weight | 552.36400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H12N6O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3,5-trinitro-2-[2-[4-[2-(2,4,6-trinitrophenyl)ethenyl]phenyl]ethenyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H12N6O12 |
|---|---|
| Molecular Weight | 552.36400 |
| Exact Mass | 552.05100 |
| PSA | 274.92000 |
| LogP | 8.61580 |
| InChIKey | IDFOXSJEAJSMQX-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(C=Cc2ccc(C=Cc3c([N+](=O)[O-])cc([N+](=O)[O-])cc3[N+](=O)[O-])cc2)c([N+](=O)[O-])c1 |
|
~%
1,3,5-trinitro-... CAS#:133502-79-1 |
| Literature: Gey et al. Journal of the American Chemical Society, 1956 , vol. 78, p. 1803,1804 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzene,1,4-bis[2-(2,4,6-trinitrophenyl)ethenyl] |