9-Phenyl-4H-pyrido[1,2-a]pyrimidin-4-one
Modify Date: 2026-08-13 22:19:16
![9-Phenyl-4H-pyrido[1,2-a]pyrimidin-4-one Structure](https://www.chemsrc.com/extcaspic/316/1335239-77-4.png)
9-Phenyl-4H-pyrido[1,2-a]pyrimidin-4-one structure
|
Common Name | 9-Phenyl-4H-pyrido[1,2-a]pyrimidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 1335239-77-4 | Molecular Weight | 222.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 9-Phenyl-4H-pyrido[1,2-a]pyrimidin-4-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H10N2O |
|---|---|
| Molecular Weight | 222.24 |
| InChIKey | WWGSUSNBPCVMNS-UHFFFAOYSA-N |
| SMILES | O=c1ccnc2c(-c3ccccc3)cccn12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1335239-77-4? |
| A: Chinese name of 1335239-77-4 is 1335239-77-4. |
| Q: What is the SMILES notation of 9-Phenyl-4H-pyrido[1,2-a]pyrimidin-4-one? |
| A: SMILES notation of 9-Phenyl-4H-pyrido[1,2-a]pyrimidin-4-one is O=c1ccnc2c(-c3ccccc3)cccn12. |
| Q: What is the English name of 9-Phenyl-4H-pyrido[1,2-a]pyrimidin-4-one? |
| A: The English name of 9-Phenyl-4H-pyrido[1,2-a]pyrimidin-4-one is 9-Phenyl-4H-pyrido[1,2-a]pyrimidin-4-one. |
| Q: What is the molecular weight of 9-Phenyl-4H-pyrido[1,2-a]pyrimidin-4-one? |
| A: Molecular weight of 9-Phenyl-4H-pyrido[1,2-a]pyrimidin-4-one is 222.24. |
| Q: What is the molecular formula of 9-Phenyl-4H-pyrido[1,2-a]pyrimidin-4-one? |
| A: Molecular formula of 9-Phenyl-4H-pyrido[1,2-a]pyrimidin-4-one is C14H10N2O. |
| Q: What is the CAS number of 9-Phenyl-4H-pyrido[1,2-a]pyrimidin-4-one? |
| A: CAS number of 9-Phenyl-4H-pyrido[1,2-a]pyrimidin-4-one is 1335239-77-4. |
| Q: What is the InChIKey of 9-Phenyl-4H-pyrido[1,2-a]pyrimidin-4-one? |
| A: InChIKey of 9-Phenyl-4H-pyrido[1,2-a]pyrimidin-4-one is WWGSUSNBPCVMNS-UHFFFAOYSA-N. |