Boc-Glutaminol structure
|
Common Name | Boc-Glutaminol | ||
|---|---|---|---|---|
| CAS Number | 133565-42-1 | Molecular Weight | 232.27700 | |
| Density | 1.135 g/cm3 | Boiling Point | 466.7ºC at 760 mmHg | |
| Molecular Formula | C10H20N2O4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 236.1ºC | |
| Name | Boc-L-Glutaminol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.135 g/cm3 |
|---|---|
| Boiling Point | 466.7ºC at 760 mmHg |
| Molecular Formula | C10H20N2O4 |
| Molecular Weight | 232.27700 |
| Flash Point | 236.1ºC |
| Exact Mass | 232.14200 |
| PSA | 101.65000 |
| LogP | 1.22870 |
| Vapour Pressure | 1.13E-10mmHg at 25°C |
| Index of Refraction | 1.486 |
| InChIKey | UHPHBGOYBNCKNT-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CO)CCC(N)=O |
| Storage condition | -15°C |
|
~%
Boc-Glutaminol CAS#:133565-42-1 |
| Literature: Tetrahedron Letters, , vol. 32, # 7 p. 923 - 926 |
|
~%
Boc-Glutaminol CAS#:133565-42-1 |
| Literature: Tetrahedron Letters, , vol. 34, # 41 p. 6513 - 6516 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Boc-Glutaminol |
| tert-butyl N-[(2S)-5-amino-1-hydroxy-5-oxopentan-2-yl]carbamate |
| (S)-tert-Butyl (5-amino-1-hydroxy-5-oxopentan-2-yl)carbamate |