3'-Methoxycoumestrol
3'-Methoxycoumestrol structure
|
Common Name | 3'-Methoxycoumestrol | ||
|---|---|---|---|---|
| CAS Number | 13360-66-2 | Molecular Weight | 298.24700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H10O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,9-dihydroxy-8-methoxy-[1]benzofuro[3,2-c]chromen-6-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H10O6 |
|---|---|
| Molecular Weight | 298.24700 |
| Exact Mass | 298.04800 |
| PSA | 93.04000 |
| LogP | 3.11220 |
| InChIKey | MQORJFLPGOCLDS-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1O)oc1c3ccc(O)cc3oc(=O)c21 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
CAS#:1700-37-4
CAS#:3769-41-3
CAS#:76240-25-0This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3'-Methoxycoumestrol |
| 7,12-Dihydroxy-11-methoxycoumestan |
| 3,9-Dihydroxy-8-methoxy-6H-benzofuro(3,2-c)(1)benzopyran-6-one |
| 6H-Benzofuro(3,2-c)(1)benzopyran-6-one,3,9-dihydroxy-8-methoxy |
| 8-Methoxycoumestrol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 3,9-dihydroxy-8-methoxy-[1]benzofuro[3,2-c]chromen-6-one? |
| A: LogP of 3,9-dihydroxy-8-methoxy-[1]benzofuro[3,2-c]chromen-6-one is 3.11220. |
| Q: What English synonyms does 3,9-dihydroxy-8-methoxy-[1]benzofuro[3,2-c]chromen-6-one have? |
| A: English synonyms of 3,9-dihydroxy-8-methoxy-[1]benzofuro[3,2-c]chromen-6-one: 3'-Methoxycoumestrol, 7,12-Dihydroxy-11-methoxycoumestan, 3,9-Dihydroxy-8-methoxy-6H-benzofuro(3,2-c)(1)benzopyran-6-one, 6H-Benzofuro(3,2-c)(1)benzopyran-6-one,3,9-dihydroxy-8-methoxy, 8-Methoxycoumestrol. |
| Q: What is the Chinese name of 13360-66-2? |
| A: Chinese name of 13360-66-2 is 13360-66-2. |
| Q: What is the SMILES notation of 3,9-dihydroxy-8-methoxy-[1]benzofuro[3,2-c]chromen-6-one? |
| A: SMILES notation of 3,9-dihydroxy-8-methoxy-[1]benzofuro[3,2-c]chromen-6-one is COc1cc2c(cc1O)oc1c3ccc(O)cc3oc(=O)c21. |
| Q: What is the molecular weight of 3,9-dihydroxy-8-methoxy-[1]benzofuro[3,2-c]chromen-6-one? |
| A: Molecular weight of 3,9-dihydroxy-8-methoxy-[1]benzofuro[3,2-c]chromen-6-one is 298.24700. |
| Q: What is the molecular formula of 3,9-dihydroxy-8-methoxy-[1]benzofuro[3,2-c]chromen-6-one? |
| A: Molecular formula of 3,9-dihydroxy-8-methoxy-[1]benzofuro[3,2-c]chromen-6-one is C16H10O6. |
| Q: What is the InChIKey of 3,9-dihydroxy-8-methoxy-[1]benzofuro[3,2-c]chromen-6-one? |
| A: InChIKey of 3,9-dihydroxy-8-methoxy-[1]benzofuro[3,2-c]chromen-6-one is MQORJFLPGOCLDS-UHFFFAOYSA-N. |
| Q: What is the CAS number of 3,9-dihydroxy-8-methoxy-[1]benzofuro[3,2-c]chromen-6-one? |
| A: CAS number of 3,9-dihydroxy-8-methoxy-[1]benzofuro[3,2-c]chromen-6-one is 13360-66-2. |
| Q: What is the polar surface area (PSA) of 3,9-dihydroxy-8-methoxy-[1]benzofuro[3,2-c]chromen-6-one? |
| A: Polar surface area (PSA) of 3,9-dihydroxy-8-methoxy-[1]benzofuro[3,2-c]chromen-6-one is 93.04000. |
| Q: What are the upstream materials of 3,9-dihydroxy-8-methoxy-[1]benzofuro[3,2-c]chromen-6-one? |
| A: Related upstream materials(CAS) of 3,9-dihydroxy-8-methoxy-[1]benzofuro[3,2-c]chromen-6-one: 1700-37-4;3769-41-3;76240-25-0. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |