2-(bromomethyl)-1-nitro-4-(trifluoromethyl)benzene structure
|
Common Name | 2-(bromomethyl)-1-nitro-4-(trifluoromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 133605-28-4 | Molecular Weight | 284.03000 | |
| Density | 1.728g/cm3 | Boiling Point | 276.4ºC at 760 mmHg | |
| Molecular Formula | C8H5BrF3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 121ºC | |
| Name | 2-(bromomethyl)-1-nitro-4-(trifluoromethyl)benzene |
|---|
| Density | 1.728g/cm3 |
|---|---|
| Boiling Point | 276.4ºC at 760 mmHg |
| Molecular Formula | C8H5BrF3NO2 |
| Molecular Weight | 284.03000 |
| Flash Point | 121ºC |
| Exact Mass | 282.94600 |
| PSA | 45.82000 |
| LogP | 4.03170 |
| Vapour Pressure | 0.00808mmHg at 25°C |
| Index of Refraction | 1.526 |
| InChIKey | WJRRHFDQKYISTH-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(C(F)(F)F)cc1CBr |
| HS Code | 2904909090 |
|---|
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |