(S)-2,2,2-Trifluoro-1-(6-fluoro-1H-indol-3-YL)ethan-1-amine
Modify Date: 2025-09-09 17:12:30
(S)-2,2,2-Trifluoro-1-(6-fluoro-1H-indol-3-YL)ethan-1-amine structure
|
Common Name | (S)-2,2,2-Trifluoro-1-(6-fluoro-1H-indol-3-YL)ethan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 1336070-92-8 | Molecular Weight | 232.18 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8F4N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (S)-2,2,2-Trifluoro-1-(6-fluoro-1H-indol-3-YL)ethan-1-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H8F4N2 |
|---|---|
| Molecular Weight | 232.18 |
| InChIKey | ZQFOBJRXIRDLPF-VIFPVBQESA-N |
| SMILES | NC(c1c[nH]c2cc(F)ccc12)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1336070-92-8? |
| A: Chinese name of 1336070-92-8 is 1336070-92-8. |
| Q: What is the SMILES notation of (S)-2,2,2-Trifluoro-1-(6-fluoro-1H-indol-3-YL)ethan-1-amine? |
| A: SMILES notation of (S)-2,2,2-Trifluoro-1-(6-fluoro-1H-indol-3-YL)ethan-1-amine is NC(c1c[nH]c2cc(F)ccc12)C(F)(F)F. |
| Q: What is the CAS number of (S)-2,2,2-Trifluoro-1-(6-fluoro-1H-indol-3-YL)ethan-1-amine? |
| A: CAS number of (S)-2,2,2-Trifluoro-1-(6-fluoro-1H-indol-3-YL)ethan-1-amine is 1336070-92-8. |
| Q: What is the molecular formula of (S)-2,2,2-Trifluoro-1-(6-fluoro-1H-indol-3-YL)ethan-1-amine? |
| A: Molecular formula of (S)-2,2,2-Trifluoro-1-(6-fluoro-1H-indol-3-YL)ethan-1-amine is C10H8F4N2. |
| Q: What is the molecular weight of (S)-2,2,2-Trifluoro-1-(6-fluoro-1H-indol-3-YL)ethan-1-amine? |
| A: Molecular weight of (S)-2,2,2-Trifluoro-1-(6-fluoro-1H-indol-3-YL)ethan-1-amine is 232.18. |
| Q: What is the English name of (S)-2,2,2-Trifluoro-1-(6-fluoro-1H-indol-3-YL)ethan-1-amine? |
| A: The English name of (S)-2,2,2-Trifluoro-1-(6-fluoro-1H-indol-3-YL)ethan-1-amine is (S)-2,2,2-Trifluoro-1-(6-fluoro-1H-indol-3-YL)ethan-1-amine. |
| Q: What is the InChIKey of (S)-2,2,2-Trifluoro-1-(6-fluoro-1H-indol-3-YL)ethan-1-amine? |
| A: InChIKey of (S)-2,2,2-Trifluoro-1-(6-fluoro-1H-indol-3-YL)ethan-1-amine is ZQFOBJRXIRDLPF-VIFPVBQESA-N. |