11-ethyl-5H-dipyrido[2,3-b:2',3'-f][1,4]diazepin-6-one structure
|
Common Name | 11-ethyl-5H-dipyrido[2,3-b:2',3'-f][1,4]diazepin-6-one | ||
|---|---|---|---|---|
| CAS Number | 133626-96-7 | Molecular Weight | 240.26100 | |
| Density | 1.255g/cm3 | Boiling Point | 364.6ºC at 760 mmHg | |
| Molecular Formula | C13H12N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.3ºC | |
| Name | 11-ethyl-5H-dipyrido[2,3-b:2',3'-f][1,4]diazepin-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.255g/cm3 |
|---|---|
| Boiling Point | 364.6ºC at 760 mmHg |
| Molecular Formula | C13H12N4O |
| Molecular Weight | 240.26100 |
| Flash Point | 174.3ºC |
| Exact Mass | 240.10100 |
| PSA | 61.61000 |
| LogP | 2.08490 |
| Vapour Pressure | 1.67E-05mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | XWNWRXNJXBUCDH-UHFFFAOYSA-N |
| SMILES | CCN1c2ncccc2NC(=O)c2cccnc21 |
|
~%
11-ethyl-5H-dip... CAS#:133626-96-7 |
| Literature: Hargrave, Karl D.; Proudfoot, John R.; Grozinger, Karl G.; Cullen, Ernest; Kapadia, Suresh R.; et al. Journal of Medicinal Chemistry, 1991 , vol. 34, # 7 p. 2231 - 2241 |
|
~%
11-ethyl-5H-dip... CAS#:133626-96-7 |
| Literature: Hargrave, Karl D.; Proudfoot, John R.; Grozinger, Karl G.; Cullen, Ernest; Kapadia, Suresh R.; et al. Journal of Medicinal Chemistry, 1991 , vol. 34, # 7 p. 2231 - 2241 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N11-Ethyl-5,11-dihydro-6H-dipyrido[3,2-b:2',3'-e][1,4]diazepin-6-one |
| Dipyridodiazepinone deriv. 70 |