N-[(E)-1-(2-chlorophenyl)ethylideneamino]-1,5-dimethylpyrrole-2-carboxamide structure
|
Common Name | N-[(E)-1-(2-chlorophenyl)ethylideneamino]-1,5-dimethylpyrrole-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 133662-14-3 | Molecular Weight | 289.76000 | |
| Density | 1.201g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H16ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[(E)-1-(2-chlorophenyl)ethylideneamino]-1,5-dimethylpyrrole-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.201g/cm3 |
|---|---|
| Molecular Formula | C15H16ClN3O |
| Molecular Weight | 289.76000 |
| Exact Mass | 289.09800 |
| PSA | 46.39000 |
| LogP | 3.53180 |
| Index of Refraction | 1.591 |
| InChIKey | VLFGAFRBUKDEGS-GZTJUZNOSA-N |
| SMILES | CC(=NNC(=O)c1ccc(C)n1C)c1ccccc1Cl |
|
~60%
N-[(E)-1-(2-chl... CAS#:133662-14-3 |
| Literature: Galons; Cave; Miocque; Rinjard; Tran; Binet European Journal of Medicinal Chemistry, 1990 , vol. 25, # 9 p. 785 - 788 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| (E)-1,5-Dimethyl-1H-pyrrole-2-carboxylic acid (1-(2-chlorophenyl)ethylidene)hydrazide |
| 1H-Pyrrole-2-carboxylic acid,1,5-dimethyl-,(1-(2-chlorophenyl)ethylidene)hydrazide,(E) |