2,2-DIFLUORO-1-PHENYL-BUTANE-1,3-DIONE structure
|
Common Name | 2,2-DIFLUORO-1-PHENYL-BUTANE-1,3-DIONE | ||
|---|---|---|---|---|
| CAS Number | 133860-73-8 | Molecular Weight | 198.166 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 258.7±35.0 °C at 760 mmHg | |
| Molecular Formula | C10H8F2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 98.7±20.1 °C | |
| Name | 2,2-difluoro-1-phenylbutane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 258.7±35.0 °C at 760 mmHg |
| Molecular Formula | C10H8F2O2 |
| Molecular Weight | 198.166 |
| Flash Point | 98.7±20.1 °C |
| Exact Mass | 198.049240 |
| PSA | 34.14000 |
| LogP | 3.24 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.478 |
| InChIKey | BAMPPWBGPVMCLP-UHFFFAOYSA-N |
| SMILES | CC(=O)C(F)(F)C(=O)c1ccccc1 |
| HS Code | 2914700090 |
|---|
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1,3-Butanedione, 2,2-difluoro-1-phenyl- |
| 1,3-BUTANEDIONE,2,2-DIFLUORO-1-PHENYL |
| 2,2-Difluoro-1-phenyl-butane-1,3-dione |
| 1-phenyl-2,2-difluoro-1,3-butanedione |
| 2,2-Difluoro-1-phenylbutane-1,3-dione |
| 2,2-Difluoro-1-phenyl-1,3-butanedione |