Benzo[1,2-d:5,4-d]bisthiazole-2,6(3H,5H)-dione (7CI,8CI) structure
|
Common Name | Benzo[1,2-d:5,4-d]bisthiazole-2,6(3H,5H)-dione (7CI,8CI) | ||
|---|---|---|---|---|
| CAS Number | 13387-16-1 | Molecular Weight | 230.307 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H10N2O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3H,5H-benzo[1,2-d,5,4-d']bisthiazole-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C8H10N2O2S2 |
| Molecular Weight | 230.307 |
| Exact Mass | 230.018372 |
| PSA | 115.78000 |
| LogP | -0.32 |
| Index of Refraction | 1.626 |
| InChIKey | GHISFCSZOFBTGN-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c2cc3[nH]c(=O)sc3cc2s1 |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2,6-Dihydroxy-benzo<1,2-d:5,4-d'>bis-thiazol |
| Benzo[1,2-d:5,4-d']bisthiazole-2,6(3H,4H)-dione, hexahydro- |
| Benzo[1,2-d:5,4-d]bisthiazole-2,6(3H,5H)-dione (7CI,8CI) |
| 2,6-Dihydroxy-benzo-bis-thiazol |
| Hexahydro[1,3]thiazolo[4,5-f][1,3]benzothiazole-2,6(3H,4H)-dione |