2-(6-amino-8-methylamino-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol structure
|
Common Name | 2-(6-amino-8-methylamino-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol | ||
|---|---|---|---|---|
| CAS Number | 13389-13-4 | Molecular Weight | 296.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16N6O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 2-(6-amino-8-methylamino-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol8-(Methylamino)adenosine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
| Name | 2-[6-amino-8-(methylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| Synonym | More Synonyms |
| Description | 8-(Methylamino)adenosine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C11H16N6O4 |
|---|---|
| Molecular Weight | 296.28 |
| Exact Mass | 296.12300 |
| PSA | 154.80000 |
| InChIKey | ISWTXTWJONWIEN-UHFFFAOYSA-N |
| SMILES | CNc1nc2c(N)ncnc2n1C1OC(CO)C(O)C1O |
| n8-methyl-9-pentofuranosyl-9h-purine-6,8-diamine |
| 8-methylamino-adenosine |