IRE1α kinase-IN-9 structure
|
Common Name | IRE1α kinase-IN-9 | ||
|---|---|---|---|---|
| CAS Number | 1338933-30-4 | Molecular Weight | 436.46 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H24N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of IRE1α kinase-IN-9IRE1α kinase-IN-9 (compound 2) is a potent IRE-1α inhibitor,exhibits an average IC50 value of <0.1 μM. IRE1α kinase-IN-9 can be used for research in diseases associated with the unfolded protein response or with regulated IRE1-dependent decay (RIDD)[1]. |
| Name | IRE1α kinase-IN-9 |
|---|
| Description | IRE1α kinase-IN-9 (compound 2) is a potent IRE-1α inhibitor,exhibits an average IC50 value of <0.1 μM. IRE1α kinase-IN-9 can be used for research in diseases associated with the unfolded protein response or with regulated IRE1-dependent decay (RIDD)[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: <0.1 μM (IRE1α)[1] |
| References |
| Molecular Formula | C24H24N2O6 |
|---|---|
| Molecular Weight | 436.46 |
| InChIKey | NQUKAQJMGQBCMS-UHFFFAOYSA-N |
| SMILES | Cc1c(-c2ccc(C(=O)NCCN3CCOCC3)cc2)c(=O)oc2c(C=O)c(O)ccc12 |