Boc-Glu-OFm structure
|
Common Name | Boc-Glu-OFm | ||
|---|---|---|---|---|
| CAS Number | 133906-29-3 | Molecular Weight | 425.47400 | |
| Density | 1.232g/cm3 | Boiling Point | 638.1ºC at 760 mmHg | |
| Molecular Formula | C24H27NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 339.7ºC | |
Use of Boc-Glu-OFmBoc-Glu-Ofm is a peptide. Boc-Glu-Ofm has been used for the synthesis of ester insulin and cyclic peptide mixtures[1][2]. |
| Name | (4S)-5-(9H-fluoren-9-ylmethoxy)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Boc-Glu-Ofm is a peptide. Boc-Glu-Ofm has been used for the synthesis of ester insulin and cyclic peptide mixtures[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.232g/cm3 |
|---|---|
| Boiling Point | 638.1ºC at 760 mmHg |
| Molecular Formula | C24H27NO6 |
| Molecular Weight | 425.47400 |
| Flash Point | 339.7ºC |
| Exact Mass | 425.18400 |
| PSA | 105.42000 |
| LogP | 4.30460 |
| Vapour Pressure | 3.72E-17mmHg at 25°C |
| Index of Refraction | 1.57 |
| InChIKey | KSYVYHUPZNONJS-FQEVSTJZSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CCC(=O)O)C(=O)OCC1c2ccccc2-c2ccccc21 |
| L-Glutamic acid,N-((1,1-dimethylethoxy)carbonyl)-,1-(9H-fluoren-9-ylmethyl) ester |
| Boc-Glu-Ofm |