5-Bromo-3-indoxyl nonanoate structure
|
Common Name | 5-Bromo-3-indoxyl nonanoate | ||
|---|---|---|---|---|
| CAS Number | 133950-70-6 | Molecular Weight | 352.26600 | |
| Density | 1.298g/cm3 | Boiling Point | 464ºC at 760mmHg | |
| Molecular Formula | C17H22BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.4ºC | |
| Name | (5-bromo-1H-indol-3-yl) nonanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.298g/cm3 |
|---|---|
| Boiling Point | 464ºC at 760mmHg |
| Molecular Formula | C17H22BrNO2 |
| Molecular Weight | 352.26600 |
| Flash Point | 234.4ºC |
| Exact Mass | 351.08300 |
| PSA | 42.09000 |
| LogP | 5.58640 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | KWRFASVVDCCIEJ-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC(=O)Oc1c[nH]c2ccc(Br)cc12 |
| Storage condition | -20°C |
|
~%
5-Bromo-3-indox... CAS#:133950-70-6 |
| Literature: Agban; Ounanian; Luu-Duc; Monget European Journal of Medicinal Chemistry, 1990 , vol. 25, # 8 p. 697 - 699 |
| BIB1409 |
| B-8910 |
| 5-Bromo-3-indolyl nonanoate |
| pelargonate de bromo-5 indoxyle |