5-Bromo-3-indolyldecanoate structure
|
Common Name | 5-Bromo-3-indolyldecanoate | ||
|---|---|---|---|---|
| CAS Number | 133950-71-7 | Molecular Weight | 366.29300 | |
| Density | 1.272g/cm3 | Boiling Point | 475.3ºC at 760mmHg | |
| Molecular Formula | C18H24BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.3ºC | |
| Name | (5-bromo-1H-indol-3-yl) decanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.272g/cm3 |
|---|---|
| Boiling Point | 475.3ºC at 760mmHg |
| Molecular Formula | C18H24BrNO2 |
| Molecular Weight | 366.29300 |
| Flash Point | 241.3ºC |
| Exact Mass | 365.09900 |
| PSA | 42.09000 |
| LogP | 5.97650 |
| Vapour Pressure | 3.35E-09mmHg at 25°C |
| Index of Refraction | 1.571 |
| InChIKey | MSQDUIOYSURQKS-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(=O)Oc1c[nH]c2ccc(Br)cc12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-BROMO-3-INDOLYL DECANOATE |
| 5-Bromo-1H-indol-3-yl decanoate |
| BIB1404 |
| caprate de bromo-5 indoxyle |
| Decanoic acid,5-bromo-1H-indol-3-yl ester |