3-(2-aminoethyl)-4,7-difluoro-1H-indole-5,6-diol,2-amino-3-methyl-4H-imidazol-5-one,sulfuric acid structure
|
Common Name | 3-(2-aminoethyl)-4,7-difluoro-1H-indole-5,6-diol,2-amino-3-methyl-4H-imidazol-5-one,sulfuric acid | ||
|---|---|---|---|---|
| CAS Number | 133983-26-3 | Molecular Weight | 439.39200 | |
| Density | N/A | Boiling Point | 445.9ºC at 760mmHg | |
| Molecular Formula | C14H19F2N5O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.5ºC | |
| Name | 3-(2-aminoethyl)-4,7-difluoro-1H-indole-5,6-diol,2-amino-3-methyl-4H-imidazol-5-one,sulfuric acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 445.9ºC at 760mmHg |
|---|---|
| Molecular Formula | C14H19F2N5O7S |
| Molecular Weight | 439.39200 |
| Flash Point | 223.5ºC |
| Exact Mass | 439.09700 |
| PSA | 224.93000 |
| LogP | 1.78310 |
| Vapour Pressure | 1.44E-08mmHg at 25°C |
| InChIKey | DPIHOKBTEPDNAI-UHFFFAOYSA-N |
| SMILES | CN1CC(=O)N=C1N.NCCc1c[nH]c2c(F)c(O)c(O)c(F)c12.O=S(=O)(O)O |
| 4,7-Dfdtc |
| 2-Amino-1,5-dihydro-1-methyl-4H-imidazol-4-one compd. with 3-(2-aminoethyl)-4,7-difluoro-1H-indole-5,6-diol sulfate (1:1:1) |
| 3-(2-aminoethyl)-4,7-difluoro-1H-indole-5,6-diol |
| 4H-Imidazol-4-one,2-amino-1,5-dihydro-1-methyl-,compd. with 3-(2-aminoethyl)-4,7-difluoro-1H-indole-5,6-diol sulfate (1:1:1) |
| 4,7-difluoro-5,6-dihydroxytryptamine creatinine sulfate |
| 4,7-Difluoro-5,6-dihydroxytryptamine creatinine |