2,4(1H,3H)-Pteridinedione,7-methyl- structure
|
Common Name | 2,4(1H,3H)-Pteridinedione,7-methyl- | ||
|---|---|---|---|---|
| CAS Number | 13401-38-2 | Molecular Weight | 178.14800 | |
| Density | 1.436g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H6N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-methyl-1H-pteridine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.436g/cm3 |
|---|---|
| Molecular Formula | C7H6N4O2 |
| Molecular Weight | 178.14800 |
| Exact Mass | 178.04900 |
| PSA | 91.50000 |
| Index of Refraction | 1.588 |
| InChIKey | WIXGFZWEUAUYGB-UHFFFAOYSA-N |
| SMILES | Cc1cnc2c(=O)[nH]c(=O)[nH]c2n1 |
| HS Code | 2933990090 |
|---|
|
~%
2,4(1H,3H)-Pter... CAS#:13401-38-2 |
| Literature: Journal of the American Chemical Society, , vol. 74, p. 408,410 |
|
~75%
2,4(1H,3H)-Pter... CAS#:13401-38-2 |
| Literature: Singh; Geetanjali Russian Journal of Organic Chemistry, 2006 , vol. 42, # 1 p. 136 - 138 |
|
~%
2,4(1H,3H)-Pter... CAS#:13401-38-2 |
| Literature: Chemische Berichte, , vol. 70, p. 761,765 |
| Precursor 4 | |
|---|---|
| DownStream 5 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-Methylpteridine-2,4-diol |
| 7-Methyllumazine |
| 7-Methyllumizine |
| Lumazine,7-methyl |
| 7-Methyl-lumazin |
| 7-Methyl-1H-pteridin-2,4-dion |