Butanedioic acid, 2-methylene-, 1,4-bis(2-chloroethyl)ester structure
|
Common Name | Butanedioic acid, 2-methylene-, 1,4-bis(2-chloroethyl)ester | ||
|---|---|---|---|---|
| CAS Number | 13401-96-2 | Molecular Weight | 255.09500 | |
| Density | 1.264g/cm3 | Boiling Point | 354.3ºC at 760mmHg | |
| Molecular Formula | C9H12Cl2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 146.6ºC | |
| Name | bis(2-chloroethyl) 2-methylidenebutanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.264g/cm3 |
|---|---|
| Boiling Point | 354.3ºC at 760mmHg |
| Molecular Formula | C9H12Cl2O4 |
| Molecular Weight | 255.09500 |
| Flash Point | 146.6ºC |
| Exact Mass | 254.01100 |
| PSA | 52.60000 |
| LogP | 1.49670 |
| Vapour Pressure | 3.38E-05mmHg at 25°C |
| Index of Refraction | 1.472 |
| InChIKey | KGISSZJZXPWHMQ-UHFFFAOYSA-N |
| SMILES | C=C(CC(=O)OCCCl)C(=O)OCCCl |
| HS Code | 2917190090 |
|---|
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Butanedioic acid,2-methylene-,1,4-bis(2-chloroethyl)ester |
| Itaconsaeure-bis-<2-chlor-ethylester> |