4-chloro-3-phenyl-6H-[1,2]oxazolo[4,5-d]pyridazin-7-one
Modify Date: 2025-09-09 12:58:49
![4-chloro-3-phenyl-6H-[1,2]oxazolo[4,5-d]pyridazin-7-one Structure](https://www.chemsrc.com/extcaspic/106/13402-57-8.png)
4-chloro-3-phenyl-6H-[1,2]oxazolo[4,5-d]pyridazin-7-one structure
|
Common Name | 4-chloro-3-phenyl-6H-[1,2]oxazolo[4,5-d]pyridazin-7-one | ||
|---|---|---|---|---|
| CAS Number | 13402-57-8 | Molecular Weight | 247.64 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H6ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-chloro-3-phenyl-6H-[1,2]oxazolo[4,5-d]pyridazin-7-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H6ClN3O2 |
|---|---|
| Molecular Weight | 247.64 |
| InChIKey | CWVOULAANHVLKW-UHFFFAOYSA-N |
| SMILES | O=c1[nH]nc(Cl)c2c(-c3ccccc3)noc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4-chloro-3-phenyl-6H-[1,2]oxazolo[4,5-d]pyridazin-7-one? |
| A: CAS number of 4-chloro-3-phenyl-6H-[1,2]oxazolo[4,5-d]pyridazin-7-one is 13402-57-8. |
| Q: What is the Chinese name of 13402-57-8? |
| A: Chinese name of 13402-57-8 is 13402-57-8. |
| Q: What is the SMILES notation of 4-chloro-3-phenyl-6H-[1,2]oxazolo[4,5-d]pyridazin-7-one? |
| A: SMILES notation of 4-chloro-3-phenyl-6H-[1,2]oxazolo[4,5-d]pyridazin-7-one is O=c1[nH]nc(Cl)c2c(-c3ccccc3)noc12. |
| Q: What is the molecular weight of 4-chloro-3-phenyl-6H-[1,2]oxazolo[4,5-d]pyridazin-7-one? |
| A: Molecular weight of 4-chloro-3-phenyl-6H-[1,2]oxazolo[4,5-d]pyridazin-7-one is 247.64. |
| Q: What is the molecular formula of 4-chloro-3-phenyl-6H-[1,2]oxazolo[4,5-d]pyridazin-7-one? |
| A: Molecular formula of 4-chloro-3-phenyl-6H-[1,2]oxazolo[4,5-d]pyridazin-7-one is C11H6ClN3O2. |
| Q: What is the English name of 4-chloro-3-phenyl-6H-[1,2]oxazolo[4,5-d]pyridazin-7-one? |
| A: The English name of 4-chloro-3-phenyl-6H-[1,2]oxazolo[4,5-d]pyridazin-7-one is 4-chloro-3-phenyl-6H-[1,2]oxazolo[4,5-d]pyridazin-7-one. |
| Q: What is the InChIKey of 4-chloro-3-phenyl-6H-[1,2]oxazolo[4,5-d]pyridazin-7-one? |
| A: InChIKey of 4-chloro-3-phenyl-6H-[1,2]oxazolo[4,5-d]pyridazin-7-one is CWVOULAANHVLKW-UHFFFAOYSA-N. |