Methyl 3-amino-2,6-dichlorobenzoate
Modify Date: 2025-09-02 11:53:26
Methyl 3-amino-2,6-dichlorobenzoate structure
|
Common Name | Methyl 3-amino-2,6-dichlorobenzoate | ||
|---|---|---|---|---|
| CAS Number | 1340366-65-5 | Molecular Weight | 220.05 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H7Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 3-amino-2,6-dichlorobenzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H7Cl2NO2 |
|---|---|
| Molecular Weight | 220.05 |
| InChIKey | MWUILUHXIZFRLD-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c(Cl)ccc(N)c1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Methyl 3-amino-2,6-dichlorobenzoate? |
| A: SMILES notation of Methyl 3-amino-2,6-dichlorobenzoate is COC(=O)c1c(Cl)ccc(N)c1Cl. |
| Q: What is the InChIKey of Methyl 3-amino-2,6-dichlorobenzoate? |
| A: InChIKey of Methyl 3-amino-2,6-dichlorobenzoate is MWUILUHXIZFRLD-UHFFFAOYSA-N. |
| Q: What is the English name of Methyl 3-amino-2,6-dichlorobenzoate? |
| A: The English name of Methyl 3-amino-2,6-dichlorobenzoate is Methyl 3-amino-2,6-dichlorobenzoate. |
| Q: What is the Chinese name of 1340366-65-5? |
| A: Chinese name of 1340366-65-5 is 1340366-65-5. |
| Q: What is the CAS number of Methyl 3-amino-2,6-dichlorobenzoate? |
| A: CAS number of Methyl 3-amino-2,6-dichlorobenzoate is 1340366-65-5. |
| Q: What is the molecular weight of Methyl 3-amino-2,6-dichlorobenzoate? |
| A: Molecular weight of Methyl 3-amino-2,6-dichlorobenzoate is 220.05. |
| Q: What is the molecular formula of Methyl 3-amino-2,6-dichlorobenzoate? |
| A: Molecular formula of Methyl 3-amino-2,6-dichlorobenzoate is C8H7Cl2NO2. |