3,5-DIPHENYL-1-(P-TOLYL)FORMAZAN structure
|
Common Name | 3,5-DIPHENYL-1-(P-TOLYL)FORMAZAN | ||
|---|---|---|---|---|
| CAS Number | 13412-07-2 | Molecular Weight | 314.384 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 455.9±38.0 °C at 760 mmHg | |
| Molecular Formula | C20H18N4 | Melting Point | 154 °C | |
| MSDS | N/A | Flash Point | 229.5±26.8 °C | |
| Name | (E)-1-(4-Methylphenyl)-2-[(E)-phenyl(phenylhydrazono)methyl]diaze ne |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 455.9±38.0 °C at 760 mmHg |
| Melting Point | 154 °C |
| Molecular Formula | C20H18N4 |
| Molecular Weight | 314.384 |
| Flash Point | 229.5±26.8 °C |
| Exact Mass | 314.153137 |
| PSA | 49.11000 |
| LogP | 6.39 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.607 |
| InChIKey | TYLDKKLAWINVKP-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N=NC(=NNc2ccccc2)c2ccccc2)cc1 |
| HS Code | 2928000090 |
|---|
|
~%
3,5-DIPHENYL-1-... CAS#:13412-07-2 |
| Literature: Balakrishnan, R.; Srinivasan, V. S.; Venkatasubramanian, N. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1981 , vol. 20, # 5 p. 404 - 406 |
|
~%
3,5-DIPHENYL-1-... CAS#:13412-07-2 |
| Literature: v.Pechmann Chemische Berichte, 1894 , vol. 27, p. 1691 |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 1-(p-toluyl)-3,5-diphenyl-5-formazan |
| Benzenesulfonamide,3-chloro-4-(3-(4-methylphenyl)-5-oxo-1-imidazolidinyl) |
| Methanone, phenyl[(E)-2-phenyldiazenyl]-, 2-(4-methylphenyl)hydrazone, (Z)- |
| 1-(p-methylphenyl)-3,5-diphenylformazan |
| 1-(2-Chloro-4-sulfamoylphenyl)-3-(p-tolyl)-5-imidazolidinone |
| (E)-1-[(Z)-[(4-Methylphenyl)hydrazono](phenyl)methyl]-2-phenyldiazene |
| GS 345 |
| 3,N-Diphenyl-N'''-p-tolyl-formazan |
| p-Tolyltetrazolium Red Formazan |
| 3-Chloro-4-(3-(4-methylphenyl)-5-oxo-1-imidazolidinyl)benzenesulfonamide |
| 1-(p-Methylphenyl)-3-(2-chloro-4-sulphamoylphenyl)-imidazolidin-4-one |
| N-Phenyl-N'-p-tolyl-formazylbenzol |
| 1-<4-methylphenyl>-3,5-diphenylformazan |
| N-Phenyl-N'-p-tolyl-C-phenyl-formazan |
| 3-chloro-4-(5-oxo-3-p-tolyl-imidazolidin-1-yl)-benzenesulfonamide |
| 1,3-Diphenyl-5-p-methylphenylformazan |