Pentixafor structure
|
Common Name | Pentixafor | ||
|---|---|---|---|---|
| CAS Number | 1341207-62-2 | Molecular Weight | 1221.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C60H80N14O14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PentixaforPentixafor is a peptide that targets CXCR4. Pentixafor is capable of being labelled with 68Gallium (68Ga) for positron emission tomography (PET) imaging[1]. |
| Name | Pentixafor |
|---|
| Description | Pentixafor is a peptide that targets CXCR4. Pentixafor is capable of being labelled with 68Gallium (68Ga) for positron emission tomography (PET) imaging[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C60H80N14O14 |
|---|---|
| Molecular Weight | 1221.36 |
| InChIKey | OSUJVKAXNLHVRB-HUMWUIFSSA-N |
| SMILES | CN1C(=O)C(Cc2ccc(O)cc2)NC(=O)CNC(=O)C(Cc2ccc3ccccc3c2)NC(=O)C(CCCN=C(N)N)NC(=O)C1CCCNC(=O)c1ccc(CNC(=O)CN2CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC2)cc1 |