5-(2,4-Difluorophenyl)-1,3,4-oxadiazol-2-ol
Modify Date: 2025-09-19 12:12:16
5-(2,4-Difluorophenyl)-1,3,4-oxadiazol-2-ol structure
|
Common Name | 5-(2,4-Difluorophenyl)-1,3,4-oxadiazol-2-ol | ||
|---|---|---|---|---|
| CAS Number | 1341663-05-5 | Molecular Weight | 198.13 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H4F2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(2,4-Difluorophenyl)-1,3,4-oxadiazol-2-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H4F2N2O2 |
|---|---|
| Molecular Weight | 198.13 |
| InChIKey | HWDCTYHFYFHAOF-UHFFFAOYSA-N |
| SMILES | O=c1[nH]nc(-c2ccc(F)cc2F)o1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 5-(2,4-Difluorophenyl)-1,3,4-oxadiazol-2-ol? |
| A: CAS number of 5-(2,4-Difluorophenyl)-1,3,4-oxadiazol-2-ol is 1341663-05-5. |
| Q: What is the InChIKey of 5-(2,4-Difluorophenyl)-1,3,4-oxadiazol-2-ol? |
| A: InChIKey of 5-(2,4-Difluorophenyl)-1,3,4-oxadiazol-2-ol is HWDCTYHFYFHAOF-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1341663-05-5? |
| A: Chinese name of 1341663-05-5 is 1341663-05-5. |
| Q: What is the SMILES notation of 5-(2,4-Difluorophenyl)-1,3,4-oxadiazol-2-ol? |
| A: SMILES notation of 5-(2,4-Difluorophenyl)-1,3,4-oxadiazol-2-ol is O=c1[nH]nc(-c2ccc(F)cc2F)o1. |
| Q: What is the molecular weight of 5-(2,4-Difluorophenyl)-1,3,4-oxadiazol-2-ol? |
| A: Molecular weight of 5-(2,4-Difluorophenyl)-1,3,4-oxadiazol-2-ol is 198.13. |
| Q: What is the molecular formula of 5-(2,4-Difluorophenyl)-1,3,4-oxadiazol-2-ol? |
| A: Molecular formula of 5-(2,4-Difluorophenyl)-1,3,4-oxadiazol-2-ol is C8H4F2N2O2. |
| Q: What is the English name of 5-(2,4-Difluorophenyl)-1,3,4-oxadiazol-2-ol? |
| A: The English name of 5-(2,4-Difluorophenyl)-1,3,4-oxadiazol-2-ol is 5-(2,4-Difluorophenyl)-1,3,4-oxadiazol-2-ol. |