5-chlorosulfonylbenzene-1,3-dicarboxylic acid structure
|
Common Name | 5-chlorosulfonylbenzene-1,3-dicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 134178-04-4 | Molecular Weight | 264.64000 | |
| Density | 1.75g/cm3 | Boiling Point | 545ºC at 760 mmHg | |
| Molecular Formula | C8H5ClO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 283.4ºC | |
| Name | 5-chlorosulfonylbenzene-1,3-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.75g/cm3 |
|---|---|
| Boiling Point | 545ºC at 760 mmHg |
| Molecular Formula | C8H5ClO6S |
| Molecular Weight | 264.64000 |
| Flash Point | 283.4ºC |
| Exact Mass | 263.95000 |
| PSA | 117.12000 |
| LogP | 2.09130 |
| Vapour Pressure | 1.03E-12mmHg at 25°C |
| Index of Refraction | 1.617 |
| InChIKey | HPZPALJUGOSUMI-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(C(=O)O)cc(S(=O)(=O)Cl)c1 |
| HS Code | 2917399090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 5-(chlorosulfonyl)benzene-1,3-dicarboxylic acid |
| 1,3-Benzenedicarboxylicacid,5-(chlorosulfonyl) |
| 5-Chlorosulfonylisophthalic acid |