1-(2-chloro-5-oxophenothiazin-10-yl)-3-(dimethylamino)propan-1-one structure
|
Common Name | 1-(2-chloro-5-oxophenothiazin-10-yl)-3-(dimethylamino)propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 13420-96-7 | Molecular Weight | 348.84700 | |
| Density | 1.43g/cm3 | Boiling Point | 595.8ºC at 760 mmHg | |
| Molecular Formula | C17H17ClN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 314.1ºC | |
| Name | 1-(2-chloro-5-oxophenothiazin-10-yl)-3-(dimethylamino)propan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 595.8ºC at 760 mmHg |
| Molecular Formula | C17H17ClN2O2S |
| Molecular Weight | 348.84700 |
| Flash Point | 314.1ºC |
| Exact Mass | 348.07000 |
| PSA | 59.83000 |
| LogP | 4.36720 |
| Vapour Pressure | 3.68E-14mmHg at 25°C |
| Index of Refraction | 1.699 |
| InChIKey | FRCDSGBFLHMDBG-UHFFFAOYSA-N |
| SMILES | CN(C)CCC(=O)N1c2ccccc2S(=O)c2ccc(Cl)cc21 |
| HS Code | 2934300000 |
|---|
| HS Code | 2934300000 |
|---|---|
| Summary | 2934300000. other compounds containing in the structure a phenothiazine ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Acylphenothiazine |
| 10H-Phenothiazine,2-chloro-10-(3-(dimethylamino)-1-oxopropyl)-,5-oxide |
| 1-(2-chloro-5-oxido-10H-phenothiazin-10-yl)-3-(dimethylamino)propan-1-one |
| SK&Skf 17,910-A |
| F 17,910-A |